C29H51N3 — CID 137401214
(3E)-3-[(E)-4-(cyclopropylmethyl)-10,11-dimethyl-3,7-dimethylidenedodec-5-enyl]-N,N-dimethyl-2,5,6,7,8,9-hexahydro-1H-1,5-diazonin-4-amine (PubChem CID 137401214) has the molecular formula C29H51N3 and a molecular weight of 441.75 g/mol. Its IUPAC name is (3E)-3-[(E)-4-(cyclopropylmethyl)-10,11-dimethyl-3,7-dimethylidenedodec-5-enyl]-N,N-dimethyl-2,5,6,7,8,9-hexahydro-1H-1,5-diazonin-4-amine.
| Compound Name | (3E)-3-[(E)-4-(cyclopropylmethyl)-10,11-dimethyl-3,7-dimethylidenedodec-5-enyl]-N,N-dimethyl-2,5,6,7,8,9-hexahydro-1H-1,5-diazonin-4-amine |
|---|---|
| PubChem CID | 137401214 |
| Molecular Formula | C29H51N3 |
| Molecular Weight | 441.75 g/mol |
| Exact Mass | 441.41 |
| IUPAC Name | (3E)-3-[(E)-4-(cyclopropylmethyl)-10,11-dimethyl-3,7-dimethylidenedodec-5-enyl]-N,N-dimethyl-2,5,6,7,8,9-hexahydro-1H-1,5-diazonin-4-amine |
| SMILES | C=C(/C=C/C(CC1CC1)C(=C)CC/C1=C(\N(C)C)NCCCCNC1)CCC(C)C(C)C |
| InChI | InChI=1S/C29H51N3/c1-22(2)24(4)12-10-23(3)11-16-27(20-26-14-15-26)25(5)13-17-28-21-30-18-8-9-19-31-29(28)32(6)7/h11,16,22,24,26-27,30-31H,3,5,8-10,12-15,17-21H2,1-2,4,6-7H3/b16-11+,29-28+ |
| InChIKey | YHXLYZBXFCBROC-SXRWMBTRSA-N |
| XLogP | 6.67 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.75 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|