C24H38FN — CID 137401550
1-[(3E,5E,6Z,7Z)-5,6-di(ethylidene)-9,10-dimethylundeca-3,7,9-trien-3-yl]-3-(2-fluoropropan-2-yl)pyrrolidine (PubChem CID 137401550) has the molecular formula C24H38FN and a molecular weight of 359.57 g/mol. Its IUPAC name is 1-[(3E,5E,6Z,7Z)-5,6-di(ethylidene)-9,10-dimethylundeca-3,7,9-trien-3-yl]-3-(2-fluoropropan-2-yl)pyrrolidine.
| Compound Name | 1-[(3E,5E,6Z,7Z)-5,6-di(ethylidene)-9,10-dimethylundeca-3,7,9-trien-3-yl]-3-(2-fluoropropan-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 137401550 |
| Molecular Formula | C24H38FN |
| Molecular Weight | 359.57 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | 1-[(3E,5E,6Z,7Z)-5,6-di(ethylidene)-9,10-dimethylundeca-3,7,9-trien-3-yl]-3-(2-fluoropropan-2-yl)pyrrolidine |
| SMILES | C/C=C(/C=C\C(C)=C(C)C)C(=C\C)\C=C(/CC)N1CCC(C(C)(C)F)C1 |
| InChI | InChI=1S/C24H38FN/c1-9-20(13-12-19(6)18(4)5)21(10-2)16-23(11-3)26-15-14-22(17-26)24(7,8)25/h9-10,12-13,16,22H,11,14-15,17H2,1-8H3/b13-12-,20-9-,21-10+,23-16+ |
| InChIKey | SCPGNCPWCPJBGR-CGUFZEBFSA-N |
| XLogP | 7.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|