About 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde
6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde (PubChem CID 137401776) has the molecular formula C18H16F3NO
and a molecular weight of 319.33 g/mol. Its IUPAC name is 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde |
| PubChem CID | 137401776 |
| Molecular Formula | C18H16F3NO |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde |
| SMILES | O=Cc1ccc(F)c(-c2c(F)cc(C3CCCCC3)cc2F)n1 |
| InChI | InChI=1S/C18H16F3NO/c19-14-7-6-13(10-23)22-18(14)17-15(20)8-12(9-16(17)21)11-4-2-1-3-5-11/h6-11H,1-5H2 |
| InChIKey | CGCVOPNUQZDSFJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde?
The IUPAC name of 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde (CID 137401776) is 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde.
What is the SMILES notation for 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde?
The canonical SMILES for 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde is O=Cc1ccc(F)c(-c2c(F)cc(C3CCCCC3)cc2F)n1.
What is the InChIKey of 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde?
The InChIKey is CGCVOPNUQZDSFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3NO/c19-14-7-6-13(10-23)22-18(14)17-15(20)8-12(9-16(17)21)11-4-2-1-3-5-11/h6-11H,1-5H2.
What are the key properties of 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde?
6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde has a molecular weight of 319.33 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-cyclohexyl-2,6-difluorophenyl)-5-fluoropyridine-2-carbaldehyde is sourced from PubChem (CID 137401776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).