C58H36N4O2 — CID 137401870
5-(3,5-diphenylphenyl)-9-[3-[3-(5-oxobenzo[h][1,6]naphthyridin-6-yl)phenyl]phenyl]benzo[c][1,10]phenanthrolin-6-one (PubChem CID 137401870) has the molecular formula C58H36N4O2 and a molecular weight of 820.95 g/mol. Its IUPAC name is 5-(3,5-diphenylphenyl)-9-[3-[3-(5-oxobenzo[h][1,6]naphthyridin-6-yl)phenyl]phenyl]benzo[c][1,10]phenanthrolin-6-one.
| Compound Name | 5-(3,5-diphenylphenyl)-9-[3-[3-(5-oxobenzo[h][1,6]naphthyridin-6-yl)phenyl]phenyl]benzo[c][1,10]phenanthrolin-6-one |
|---|---|
| PubChem CID | 137401870 |
| Molecular Formula | C58H36N4O2 |
| Molecular Weight | 820.95 g/mol |
| Exact Mass | 820.28 |
| IUPAC Name | 5-(3,5-diphenylphenyl)-9-[3-[3-(5-oxobenzo[h][1,6]naphthyridin-6-yl)phenyl]phenyl]benzo[c][1,10]phenanthrolin-6-one |
| SMILES | O=c1c2cccnc2c2ccccc2n1-c1cccc(-c2cccc(-c3ccc4c(=O)n(-c5cc(-c6ccccc6)cc(-c6ccccc6)c5)c5c(ccc6cccnc65)c4c3)c2)c1 |
| InChI | InChI=1S/C58H36N4O2/c63-57-49-28-26-43(41-18-9-17-40(31-41)42-19-10-21-46(33-42)61-53-24-8-7-22-50(53)55-51(58(61)64)23-12-30-60-55)36-52(49)48-27-25-39-20-11-29-59-54(39)56(48)62(57)47-34-44(37-13-3-1-4-14-37)32-45(35-47)38-15-5-2-6-16-38/h1-36H |
| InChIKey | QCAGEQXUOHDZOF-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.95 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|