About 6-butylsulfanyldodecane
6-butylsulfanyldodecane (PubChem CID 137401964) has the molecular formula C16H34S
and a molecular weight of 258.51 g/mol. Its IUPAC name is 6-butylsulfanyldodecane.
Molecular Properties
| Compound Name | 6-butylsulfanyldodecane |
| PubChem CID | 137401964 |
| Molecular Formula | C16H34S |
| Molecular Weight | 258.51 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 6-butylsulfanyldodecane |
| SMILES | CCCCCCC(CCCCC)SCCCC |
| InChI | InChI=1S/C16H34S/c1-4-7-10-12-14-16(13-11-8-5-2)17-15-9-6-3/h16H,4-15H2,1-3H3 |
| InChIKey | VGNXAUZSEKYNAZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-butylsulfanyldodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butylsulfanyldodecane?
The IUPAC name of 6-butylsulfanyldodecane (CID 137401964) is 6-butylsulfanyldodecane.
What is the SMILES notation for 6-butylsulfanyldodecane?
The canonical SMILES for 6-butylsulfanyldodecane is CCCCCCC(CCCCC)SCCCC.
What is the InChIKey of 6-butylsulfanyldodecane?
The InChIKey is VGNXAUZSEKYNAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34S/c1-4-7-10-12-14-16(13-11-8-5-2)17-15-9-6-3/h16H,4-15H2,1-3H3.
What are the key properties of 6-butylsulfanyldodecane?
6-butylsulfanyldodecane has a molecular weight of 258.51 g/mol, XLogP of 6.44, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butylsulfanyldodecane is sourced from PubChem (CID 137401964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).