C14H25NO4 — CID 137402191
6-[butan-2-yl(hydroxy)amino]-5-hydroxy-2,2,4,4-tetramethylcyclohexane-1,3-dione (PubChem CID 137402191) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is 6-[butan-2-yl(hydroxy)amino]-5-hydroxy-2,2,4,4-tetramethylcyclohexane-1,3-dione.
| Compound Name | 6-[butan-2-yl(hydroxy)amino]-5-hydroxy-2,2,4,4-tetramethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 137402191 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 6-[butan-2-yl(hydroxy)amino]-5-hydroxy-2,2,4,4-tetramethylcyclohexane-1,3-dione |
| SMILES | CCC(C)N(O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1O |
| InChI | InChI=1S/C14H25NO4/c1-7-8(2)15(19)9-10(16)13(3,4)12(18)14(5,6)11(9)17/h8-10,16,19H,7H2,1-6H3 |
| InChIKey | RFGUVXUDLJTSNU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|