About N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine
N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine (PubChem CID 137402236) has the molecular formula C15H29FN2
and a molecular weight of 256.41 g/mol. Its IUPAC name is N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine |
| PubChem CID | 137402236 |
| Molecular Formula | C15H29FN2 |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine |
| SMILES | C=C(/C=C\CC[C@H](C)F)CCCNCCCNC |
| InChI | InChI=1S/C15H29FN2/c1-14(8-4-5-10-15(2)16)9-6-12-18-13-7-11-17-3/h4,8,15,17-18H,1,5-7,9-13H2,2-3H3/b8-4-/t15-/m0/s1 |
| InChIKey | VSLDGBMAHRJNLP-UVCVVPOWSA-N |
| XLogP | 3.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine?
The IUPAC name of N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine (CID 137402236) is N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine.
What is the SMILES notation for N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine?
The canonical SMILES for N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine is C=C(/C=C\CC[C@H](C)F)CCCNCCCNC.
What is the InChIKey of N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine?
The InChIKey is VSLDGBMAHRJNLP-UVCVVPOWSA-N. The full InChI is InChI=1S/C15H29FN2/c1-14(8-4-5-10-15(2)16)9-6-12-18-13-7-11-17-3/h4,8,15,17-18H,1,5-7,9-13H2,2-3H3/b8-4-/t15-/m0/s1.
What are the key properties of N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine?
N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine has a molecular weight of 256.41 g/mol, XLogP of 3.22, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z,9S)-9-fluoro-4-methylidenedec-5-enyl]-N-methylpropane-1,3-diamine is sourced from PubChem (CID 137402236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).