About 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile
4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile (PubChem CID 137402897) has the molecular formula C20H11Cl2N3OS2
and a molecular weight of 444.37 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile |
| PubChem CID | 137402897 |
| Molecular Formula | C20H11Cl2N3OS2 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 442.97 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)c(Cl)c2)csc1OCc1ccc(-c2csnn2)cc1 |
| InChI | InChI=1S/C20H11Cl2N3OS2/c21-17-6-5-14(7-18(17)22)16-10-27-20(15(16)8-23)26-9-12-1-3-13(4-2-12)19-11-28-25-24-19/h1-7,10-11H,9H2 |
| InChIKey | RNOCLHFCUNMGML-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile?
The IUPAC name of 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile (CID 137402897) is 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile.
What is the SMILES notation for 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile?
The canonical SMILES for 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile is N#Cc1c(-c2ccc(Cl)c(Cl)c2)csc1OCc1ccc(-c2csnn2)cc1.
What is the InChIKey of 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile?
The InChIKey is RNOCLHFCUNMGML-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11Cl2N3OS2/c21-17-6-5-14(7-18(17)22)16-10-27-20(15(16)8-23)26-9-12-1-3-13(4-2-12)19-11-28-25-24-19/h1-7,10-11H,9H2.
What are the key properties of 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile?
4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile has a molecular weight of 444.37 g/mol, XLogP of 6.69, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dichlorophenyl)-2-[[4-(thiadiazol-4-yl)phenyl]methoxy]thiophene-3-carbonitrile is sourced from PubChem (CID 137402897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).