C15H26O4 — CID 137402922
5-hydroxy-6-(1-hydroxy-2-methylbutyl)-2,2,4,4-tetramethylcyclohexane-1,3-dione (PubChem CID 137402922) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 5-hydroxy-6-(1-hydroxy-2-methylbutyl)-2,2,4,4-tetramethylcyclohexane-1,3-dione.
| Compound Name | 5-hydroxy-6-(1-hydroxy-2-methylbutyl)-2,2,4,4-tetramethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 137402922 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 5-hydroxy-6-(1-hydroxy-2-methylbutyl)-2,2,4,4-tetramethylcyclohexane-1,3-dione |
| SMILES | CCC(C)C(O)C1C(=O)C(C)(C)C(=O)C(C)(C)C1O |
| InChI | InChI=1S/C15H26O4/c1-7-8(2)10(16)9-11(17)14(3,4)13(19)15(5,6)12(9)18/h8-11,16-17H,7H2,1-6H3 |
| InChIKey | PXBJUHLQQCOXSP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|