C12H20O3 — CID 137402986
5-methylspiro[4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyran-2,2'-oxolane] (PubChem CID 137402986) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 5-methylspiro[4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyran-2,2'-oxolane].
| Compound Name | 5-methylspiro[4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyran-2,2'-oxolane] |
|---|---|
| PubChem CID | 137402986 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 5-methylspiro[4,4a,5,7,8,8a-hexahydro-3H-pyrano[3,2-c]pyran-2,2'-oxolane] |
| SMILES | CC1OCCC2OC3(CCCO3)CCC12 |
| InChI | InChI=1S/C12H20O3/c1-9-10-3-6-12(5-2-7-14-12)15-11(10)4-8-13-9/h9-11H,2-8H2,1H3 |
| InChIKey | MYPZCZDFGZEVCP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |