About [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate
[4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate (PubChem CID 137403019) has the molecular formula C13H16FNO
and a molecular weight of 221.27 g/mol. Its IUPAC name is [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate.
Molecular Properties
| Compound Name | [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate |
| PubChem CID | 137403019 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate |
| SMILES | CC(C)c1cc(F)cc(C(C)C)c1OC#N |
| InChI | InChI=1S/C13H16FNO/c1-8(2)11-5-10(14)6-12(9(3)4)13(11)16-7-15/h5-6,8-9H,1-4H3 |
| InChIKey | APFPEUAODMFJIR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate?
The IUPAC name of [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate (CID 137403019) is [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate.
What is the SMILES notation for [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate?
The canonical SMILES for [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate is CC(C)c1cc(F)cc(C(C)C)c1OC#N.
What is the InChIKey of [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate?
The InChIKey is APFPEUAODMFJIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO/c1-8(2)11-5-10(14)6-12(9(3)4)13(11)16-7-15/h5-6,8-9H,1-4H3.
What are the key properties of [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate?
[4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate has a molecular weight of 221.27 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-fluoro-2,6-di(propan-2-yl)phenyl] cyanate is sourced from PubChem (CID 137403019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).