C28H30ClN3O4 — CID 137403370
ethyl 4-[4-[6-chloro-2-(4-formylcyclohexyl)oxy-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]cyclohex-3-ene-1-carboxylate (PubChem CID 137403370) has the molecular formula C28H30ClN3O4 and a molecular weight of 508.02 g/mol. Its IUPAC name is ethyl 4-[4-[6-chloro-2-(4-formylcyclohexyl)oxy-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4-[4-[6-chloro-2-(4-formylcyclohexyl)oxy-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 137403370 |
| Molecular Formula | C28H30ClN3O4 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | ethyl 4-[4-[6-chloro-2-(4-formylcyclohexyl)oxy-1H-imidazo[4,5-b]pyridin-5-yl]phenyl]cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CC=C(c2ccc(-c3nc4nc(OC5CCC(C=O)CC5)[nH]c4cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C28H30ClN3O4/c1-2-35-27(34)21-11-7-19(8-12-21)18-5-9-20(10-6-18)25-23(29)15-24-26(31-25)32-28(30-24)36-22-13-3-17(16-33)4-14-22/h5-7,9-10,15-17,21-22H,2-4,8,11-14H2,1H3,(H,30,31,32) |
| InChIKey | IQWAWLVMJZEIIR-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|