C35H64O4 — CID 137403894
(3S)-7-[(2S,3aS,7aR)-5-butyl-2-methoxy-1-[5-(2-methoxybutan-2-yl)oxolan-2-yl]-3a,7a-dimethyl-2,3,4,7-tetrahydro-1H-inden-4-yl]-4,4,5-trimethylheptan-3-ol (PubChem CID 137403894) has the molecular formula C35H64O4 and a molecular weight of 548.89 g/mol. Its IUPAC name is (3S)-7-[(2S,3aS,7aR)-5-butyl-2-methoxy-1-[5-(2-methoxybutan-2-yl)oxolan-2-yl]-3a,7a-dimethyl-2,3,4,7-tetrahydro-1H-inden-4-yl]-4,4,5-trimethylheptan-3-ol.
| Compound Name | (3S)-7-[(2S,3aS,7aR)-5-butyl-2-methoxy-1-[5-(2-methoxybutan-2-yl)oxolan-2-yl]-3a,7a-dimethyl-2,3,4,7-tetrahydro-1H-inden-4-yl]-4,4,5-trimethylheptan-3-ol |
|---|---|
| PubChem CID | 137403894 |
| Molecular Formula | C35H64O4 |
| Molecular Weight | 548.89 g/mol |
| Exact Mass | 548.48 |
| IUPAC Name | (3S)-7-[(2S,3aS,7aR)-5-butyl-2-methoxy-1-[5-(2-methoxybutan-2-yl)oxolan-2-yl]-3a,7a-dimethyl-2,3,4,7-tetrahydro-1H-inden-4-yl]-4,4,5-trimethylheptan-3-ol |
| SMILES | CCCCC1=CC[C@]2(C)C(C3CCC(C(C)(CC)OC)O3)[C@@H](OC)C[C@@]2(C)C1CCC(C)C(C)(C)[C@@H](O)CC |
| InChI | InChI=1S/C35H64O4/c1-12-15-16-25-21-22-33(7)31(27-19-20-30(39-27)35(9,14-3)38-11)28(37-10)23-34(33,8)26(25)18-17-24(4)32(5,6)29(36)13-2/h21,24,26-31,36H,12-20,22-23H2,1-11H3/t24?,26?,27?,28-,29-,30?,31?,33+,34-,35?/m0/s1 |
| InChIKey | LMOJFWOHJQZFBU-BAEWCZCHSA-N |
| XLogP | 8.75 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.89 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|