C18H19N3O3S — CID 137403916
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-pyridin-4-ylsulfonylurea (PubChem CID 137403916) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-pyridin-4-ylsulfonylurea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-pyridin-4-ylsulfonylurea |
|---|---|
| PubChem CID | 137403916 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-pyridin-4-ylsulfonylurea |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)NS(=O)(=O)c1ccncc1 |
| InChI | InChI=1S/C18H19N3O3S/c22-18(21-25(23,24)14-7-9-19-10-8-14)20-17-15-5-1-3-12(15)11-13-4-2-6-16(13)17/h7-11H,1-6H2,(H2,20,21,22) |
| InChIKey | WSEWXPRNYSRHBR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |