About 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine
2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine (PubChem CID 137404520) has the molecular formula C11H11Cl3N4O2
and a molecular weight of 337.59 g/mol. Its IUPAC name is 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine.
Molecular Properties
| Compound Name | 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine |
| PubChem CID | 137404520 |
| Molecular Formula | C11H11Cl3N4O2 |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine |
| SMILES | CC(N)(Cn1cc2c(Cl)cc(Cl)c(Cl)c2n1)C[N+](=O)[O-] |
| InChI | InChI=1S/C11H11Cl3N4O2/c1-11(15,5-18(19)20)4-17-3-6-7(12)2-8(13)9(14)10(6)16-17/h2-3H,4-5,15H2,1H3 |
| InChIKey | KOAINUOKDLNVTP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine?
The IUPAC name of 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine (CID 137404520) is 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine.
What is the SMILES notation for 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine?
The canonical SMILES for 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine is CC(N)(Cn1cc2c(Cl)cc(Cl)c(Cl)c2n1)C[N+](=O)[O-].
What is the InChIKey of 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine?
The InChIKey is KOAINUOKDLNVTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl3N4O2/c1-11(15,5-18(19)20)4-17-3-6-7(12)2-8(13)9(14)10(6)16-17/h2-3H,4-5,15H2,1H3.
What are the key properties of 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine?
2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine has a molecular weight of 337.59 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-nitro-3-(4,6,7-trichloroindazol-2-yl)propan-2-amine is sourced from PubChem (CID 137404520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).