About but-3-enoate;tetraethylazanium
but-3-enoate;tetraethylazanium (PubChem CID 137404690) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is but-3-enoate;tetraethylazanium.
Molecular Properties
| Compound Name | but-3-enoate;tetraethylazanium |
| PubChem CID | 137404690 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | but-3-enoate;tetraethylazanium |
| SMILES | C=CCC(=O)[O-].CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C4H6O2/c1-5-9(6-2,7-3)8-4;1-2-3-4(5)6/h5-8H2,1-4H3;2H,1,3H2,(H,5,6)/q+1;/p-1 |
| InChIKey | MYJWGAITJLVXTP-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze but-3-enoate;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enoate;tetraethylazanium?
The IUPAC name of but-3-enoate;tetraethylazanium (CID 137404690) is but-3-enoate;tetraethylazanium.
What is the SMILES notation for but-3-enoate;tetraethylazanium?
The canonical SMILES for but-3-enoate;tetraethylazanium is C=CCC(=O)[O-].CC[N+](CC)(CC)CC.
What is the InChIKey of but-3-enoate;tetraethylazanium?
The InChIKey is MYJWGAITJLVXTP-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H20N.C4H6O2/c1-5-9(6-2,7-3)8-4;1-2-3-4(5)6/h5-8H2,1-4H3;2H,1,3H2,(H,5,6)/q+1;/p-1.
What are the key properties of but-3-enoate;tetraethylazanium?
but-3-enoate;tetraethylazanium has a molecular weight of 215.34 g/mol, XLogP of 1.20, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enoate;tetraethylazanium is sourced from PubChem (CID 137404690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).