C22H22O4S2 — CID 137404719
methyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]-3-(hydroxymethyl)benzoate (PubChem CID 137404719) has the molecular formula C22H22O4S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is methyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]-3-(hydroxymethyl)benzoate.
| Compound Name | methyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]-3-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 137404719 |
| Molecular Formula | C22H22O4S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | methyl 4-[2-[4,4-bis(methylsulfanyl)-2,3-dihydrochromen-6-yl]ethynyl]-3-(hydroxymethyl)benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2ccc3c(c2)C(SC)(SC)CCO3)c(CO)c1 |
| InChI | InChI=1S/C22H22O4S2/c1-25-21(24)17-8-7-16(18(13-17)14-23)6-4-15-5-9-20-19(12-15)22(27-2,28-3)10-11-26-20/h5,7-9,12-13,23H,10-11,14H2,1-3H3 |
| InChIKey | FCBWUFQGFPBHAG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|