C17H21N3O3S — CID 137405648
(3R,4R)-1-ethylsulfonyl-4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidin-3-ol (PubChem CID 137405648) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is (3R,4R)-1-ethylsulfonyl-4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidin-3-ol.
| Compound Name | (3R,4R)-1-ethylsulfonyl-4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 137405648 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (3R,4R)-1-ethylsulfonyl-4-(5H-imidazo[5,1-a]isoindol-5-yl)piperidin-3-ol |
| SMILES | CCS(=O)(=O)N1CC[C@H](C2c3ccccc3-c3cncn32)[C@@H](O)C1 |
| InChI | InChI=1S/C17H21N3O3S/c1-2-24(22,23)19-8-7-14(16(21)10-19)17-13-6-4-3-5-12(13)15-9-18-11-20(15)17/h3-6,9,11,14,16-17,21H,2,7-8,10H2,1H3/t14-,16-,17?/m0/s1 |
| InChIKey | BUFHKPUETXXQQF-CCWDIYBNSA-N |
| XLogP | 1.49 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |