About ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate
ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate (PubChem CID 137406027) has the molecular formula C14H19NO4S
and a molecular weight of 297.38 g/mol. Its IUPAC name is ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate.
Molecular Properties
| Compound Name | ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate |
| PubChem CID | 137406027 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate |
| SMILES | C=C/C(=N/OS(=O)(=O)c1c(C)cc(C)cc1C)OCC |
| InChI | InChI=1S/C14H19NO4S/c1-6-13(18-7-2)15-19-20(16,17)14-11(4)8-10(3)9-12(14)5/h6,8-9H,1,7H2,2-5H3/b15-13- |
| InChIKey | QVTZZHXZGGXAFT-SQFISAMPSA-N |
| XLogP | 2.85 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate?
The IUPAC name of ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate (CID 137406027) is ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate.
What is the SMILES notation for ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate?
The canonical SMILES for ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate is C=C/C(=N/OS(=O)(=O)c1c(C)cc(C)cc1C)OCC.
What is the InChIKey of ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate?
The InChIKey is QVTZZHXZGGXAFT-SQFISAMPSA-N. The full InChI is InChI=1S/C14H19NO4S/c1-6-13(18-7-2)15-19-20(16,17)14-11(4)8-10(3)9-12(14)5/h6,8-9H,1,7H2,2-5H3/b15-13-.
What are the key properties of ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate?
ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate has a molecular weight of 297.38 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1Z)-N-(2,4,6-trimethylphenyl)sulfonyloxyprop-2-enimidate is sourced from PubChem (CID 137406027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).