C26H20N4O4 — CID 137406231
[7-(5H-imidazo[5,1-a]isoindol-5-yl)-5,6,7,8-tetrahydroquinolin-8-yl] 4-nitrobenzoate (PubChem CID 137406231) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is [7-(5H-imidazo[5,1-a]isoindol-5-yl)-5,6,7,8-tetrahydroquinolin-8-yl] 4-nitrobenzoate.
| Compound Name | [7-(5H-imidazo[5,1-a]isoindol-5-yl)-5,6,7,8-tetrahydroquinolin-8-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 137406231 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [7-(5H-imidazo[5,1-a]isoindol-5-yl)-5,6,7,8-tetrahydroquinolin-8-yl] 4-nitrobenzoate |
| SMILES | O=C(OC1c2ncccc2CCC1C1c2ccccc2-c2cncn21)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H20N4O4/c31-26(17-7-10-18(11-8-17)30(32)33)34-25-21(12-9-16-4-3-13-28-23(16)25)24-20-6-2-1-5-19(20)22-14-27-15-29(22)24/h1-8,10-11,13-15,21,24-25H,9,12H2 |
| InChIKey | FSNDMRWGZYDTBQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|