C16H18N2O4 — CID 137406249
[2-(2-cyano-6-methoxyphenoxy)spiro[3.3]heptan-6-yl]carbamic acid (PubChem CID 137406249) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [2-(2-cyano-6-methoxyphenoxy)spiro[3.3]heptan-6-yl]carbamic acid.
| Compound Name | [2-(2-cyano-6-methoxyphenoxy)spiro[3.3]heptan-6-yl]carbamic acid |
|---|---|
| PubChem CID | 137406249 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [2-(2-cyano-6-methoxyphenoxy)spiro[3.3]heptan-6-yl]carbamic acid |
| SMILES | COc1cccc(C#N)c1OC1CC2(CC(NC(=O)O)C2)C1 |
| InChI | InChI=1S/C16H18N2O4/c1-21-13-4-2-3-10(9-17)14(13)22-12-7-16(8-12)5-11(6-16)18-15(19)20/h2-4,11-12,18H,5-8H2,1H3,(H,19,20) |
| InChIKey | RJPBJDIHIQEDKI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |