C21H23F2N3O4S — CID 137406870
(4aS,7S,8aR)-4a-[2-fluoro-5-[(3-fluoro-2-pyridinyl)oxy]phenyl]-2,2,7-trimethyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-3-amine (PubChem CID 137406870) has the molecular formula C21H23F2N3O4S and a molecular weight of 451.50 g/mol. Its IUPAC name is (4aS,7S,8aR)-4a-[2-fluoro-5-[(3-fluoro-2-pyridinyl)oxy]phenyl]-2,2,7-trimethyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-3-amine.
| Compound Name | (4aS,7S,8aR)-4a-[2-fluoro-5-[(3-fluoro-2-pyridinyl)oxy]phenyl]-2,2,7-trimethyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-3-amine |
|---|---|
| PubChem CID | 137406870 |
| Molecular Formula | C21H23F2N3O4S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (4aS,7S,8aR)-4a-[2-fluoro-5-[(3-fluoro-2-pyridinyl)oxy]phenyl]-2,2,7-trimethyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[4,3-b][1,4]thiazin-3-amine |
| SMILES | C[C@H]1C[C@@H]2[C@](c3cc(Oc4ncccc4F)ccc3F)(CO1)N=C(N)C(C)(C)S2(=O)=O |
| InChI | InChI=1S/C21H23F2N3O4S/c1-12-9-17-21(11-29-12,26-19(24)20(2,3)31(17,27)28)14-10-13(6-7-15(14)22)30-18-16(23)5-4-8-25-18/h4-8,10,12,17H,9,11H2,1-3H3,(H2,24,26)/t12-,17+,21+/m0/s1 |
| InChIKey | NUTYXXXZWVAGHN-LKNMKHRSSA-N |
| XLogP | 3.09 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |