About 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol
1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol (PubChem CID 137407419) has the molecular formula C18H17BrF4N2O
and a molecular weight of 433.24 g/mol. Its IUPAC name is 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol |
| PubChem CID | 137407419 |
| Molecular Formula | C18H17BrF4N2O |
| Molecular Weight | 433.24 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol |
| SMILES | OC(c1ccc(N2CCN(c3ccc(Br)cc3)CC2)cc1F)C(F)(F)F |
| InChI | InChI=1S/C18H17BrF4N2O/c19-12-1-3-13(4-2-12)24-7-9-25(10-8-24)14-5-6-15(16(20)11-14)17(26)18(21,22)23/h1-6,11,17,26H,7-10H2 |
| InChIKey | XQBMEEOVRYSEPC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol?
The IUPAC name of 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol (CID 137407419) is 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol.
What is the SMILES notation for 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol?
The canonical SMILES for 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol is OC(c1ccc(N2CCN(c3ccc(Br)cc3)CC2)cc1F)C(F)(F)F.
What is the InChIKey of 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol?
The InChIKey is XQBMEEOVRYSEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrF4N2O/c19-12-1-3-13(4-2-12)24-7-9-25(10-8-24)14-5-6-15(16(20)11-14)17(26)18(21,22)23/h1-6,11,17,26H,7-10H2.
What are the key properties of 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol?
1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol has a molecular weight of 433.24 g/mol, XLogP of 4.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-(4-bromophenyl)piperazin-1-yl]-2-fluorophenyl]-2,2,2-trifluoroethanol is sourced from PubChem (CID 137407419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).