C11H12FN3O2 — CID 137407547
4-(2-fluorophenyl)-2,4-dimethoxy-1H-1,3,5-triazine (PubChem CID 137407547) has the molecular formula C11H12FN3O2 and a molecular weight of 237.23 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-2,4-dimethoxy-1H-1,3,5-triazine.
| Compound Name | 4-(2-fluorophenyl)-2,4-dimethoxy-1H-1,3,5-triazine |
|---|---|
| PubChem CID | 137407547 |
| Molecular Formula | C11H12FN3O2 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 4-(2-fluorophenyl)-2,4-dimethoxy-1H-1,3,5-triazine |
| SMILES | COC1=NC(OC)(c2ccccc2F)N=CN1 |
| InChI | InChI=1S/C11H12FN3O2/c1-16-10-13-7-14-11(15-10,17-2)8-5-3-4-6-9(8)12/h3-7H,1-2H3,(H,13,14,15) |
| InChIKey | SVFZDRRETMBOCF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |