C9H11Cl2F2N3O3S — CID 137408010
[3-[(2,5-dichloropyrimidin-4-yl)amino]-4,4-difluorobutyl] methanesulfonate (PubChem CID 137408010) has the molecular formula C9H11Cl2F2N3O3S and a molecular weight of 350.17 g/mol. Its IUPAC name is [3-[(2,5-dichloropyrimidin-4-yl)amino]-4,4-difluorobutyl] methanesulfonate.
| Compound Name | [3-[(2,5-dichloropyrimidin-4-yl)amino]-4,4-difluorobutyl] methanesulfonate |
|---|---|
| PubChem CID | 137408010 |
| Molecular Formula | C9H11Cl2F2N3O3S |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | [3-[(2,5-dichloropyrimidin-4-yl)amino]-4,4-difluorobutyl] methanesulfonate |
| SMILES | CS(=O)(=O)OCCC(Nc1nc(Cl)ncc1Cl)C(F)F |
| InChI | InChI=1S/C9H11Cl2F2N3O3S/c1-20(17,18)19-3-2-6(7(12)13)15-8-5(10)4-14-9(11)16-8/h4,6-7H,2-3H2,1H3,(H,14,15,16) |
| InChIKey | VDZGWBUYMITWTC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|