C15H13F2N3O — CID 137408013
[(1S,2R)-2-fluorocyclopropyl]-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 137408013) has the molecular formula C15H13F2N3O and a molecular weight of 289.28 g/mol. Its IUPAC name is [(1S,2R)-2-fluorocyclopropyl]-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | [(1S,2R)-2-fluorocyclopropyl]-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 137408013 |
| Molecular Formula | C15H13F2N3O |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [(1S,2R)-2-fluorocyclopropyl]-[(5R,7R)-7-fluoro-5-phenyl-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | O=C(c1nc2n(n1)[C@@H](c1ccccc1)C[C@H]2F)[C@@H]1C[C@H]1F |
| InChI | InChI=1S/C15H13F2N3O/c16-10-6-9(10)13(21)14-18-15-11(17)7-12(20(15)19-14)8-4-2-1-3-5-8/h1-5,9-12H,6-7H2/t9-,10-,11-,12-/m1/s1 |
| InChIKey | FWMNSADKMMIUCS-DDHJBXDOSA-N |
| XLogP | 2.82 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |