C11H12F3N3O — CID 137408197
cyclopropyl-[(5S,7S)-5-(1,1-difluoroethyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 137408197) has the molecular formula C11H12F3N3O and a molecular weight of 259.23 g/mol. Its IUPAC name is cyclopropyl-[(5S,7S)-5-(1,1-difluoroethyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | cyclopropyl-[(5S,7S)-5-(1,1-difluoroethyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 137408197 |
| Molecular Formula | C11H12F3N3O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | cyclopropyl-[(5S,7S)-5-(1,1-difluoroethyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | CC(F)(F)[C@@H]1C[C@H](F)c2nc(C(=O)C3CC3)nn21 |
| InChI | InChI=1S/C11H12F3N3O/c1-11(13,14)7-4-6(12)10-15-9(16-17(7)10)8(18)5-2-3-5/h5-7H,2-4H2,1H3/t6-,7-/m0/s1 |
| InChIKey | VZXCPSNZIXLGCY-BQBZGAKWSA-N |
| XLogP | 2.48 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |