C12H14F3N3O — CID 137408277
cyclopropyl-[(5S,7S)-5-(1,1-difluoropropyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 137408277) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is cyclopropyl-[(5S,7S)-5-(1,1-difluoropropyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | cyclopropyl-[(5S,7S)-5-(1,1-difluoropropyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 137408277 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | cyclopropyl-[(5S,7S)-5-(1,1-difluoropropyl)-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | CCC(F)(F)[C@@H]1C[C@H](F)c2nc(C(=O)C3CC3)nn21 |
| InChI | InChI=1S/C12H14F3N3O/c1-2-12(14,15)8-5-7(13)11-16-10(17-18(8)11)9(19)6-3-4-6/h6-8H,2-5H2,1H3/t7-,8-/m0/s1 |
| InChIKey | MDZAWQBIFVIRON-YUMQZZPRSA-N |
| XLogP | 2.87 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |