C24H30FN5O — CID 137408992
4-[2-(butylamino)-5-[(4-fluorophenyl)methylamino]pyrido[4,3-d]pyrimidin-8-yl]cyclohexan-1-ol (PubChem CID 137408992) has the molecular formula C24H30FN5O and a molecular weight of 423.54 g/mol. Its IUPAC name is 4-[2-(butylamino)-5-[(4-fluorophenyl)methylamino]pyrido[4,3-d]pyrimidin-8-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(butylamino)-5-[(4-fluorophenyl)methylamino]pyrido[4,3-d]pyrimidin-8-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 137408992 |
| Molecular Formula | C24H30FN5O |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 4-[2-(butylamino)-5-[(4-fluorophenyl)methylamino]pyrido[4,3-d]pyrimidin-8-yl]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc2c(NCc3ccc(F)cc3)ncc(C3CCC(O)CC3)c2n1 |
| InChI | InChI=1S/C24H30FN5O/c1-2-3-12-26-24-29-15-21-22(30-24)20(17-6-10-19(31)11-7-17)14-28-23(21)27-13-16-4-8-18(25)9-5-16/h4-5,8-9,14-15,17,19,31H,2-3,6-7,10-13H2,1H3,(H,27,28)(H,26,29,30) |
| InChIKey | GVMQLLHNEISUHR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|