About azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine
azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine (PubChem CID 137409071) has the molecular formula C19H29N7O
and a molecular weight of 371.49 g/mol. Its IUPAC name is azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine.
Molecular Properties
| Compound Name | azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine |
| PubChem CID | 137409071 |
| Molecular Formula | C19H29N7O |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine |
| SMILES | N.N.Nc1cc(NCCC2CCOCC2)c2ccc(-c3ccn[nH]3)cc2n1 |
| InChI | InChI=1S/C19H23N5O.2H3N/c20-19-12-17(21-7-3-13-5-9-25-10-6-13)15-2-1-14(11-18(15)23-19)16-4-8-22-24-16;;/h1-2,4,8,11-13H,3,5-7,9-10H2,(H,22,24)(H3,20,21,23);2*1H3 |
| InChIKey | SYTLTRRPRLWBDF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 158.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
The IUPAC name of azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine (CID 137409071) is azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine.
What is the SMILES notation for azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
The canonical SMILES for azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine is N.N.Nc1cc(NCCC2CCOCC2)c2ccc(-c3ccn[nH]3)cc2n1.
What is the InChIKey of azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
The InChIKey is SYTLTRRPRLWBDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N5O.2H3N/c20-19-12-17(21-7-3-13-5-9-25-10-6-13)15-2-1-14(11-18(15)23-19)16-4-8-22-24-16;;/h1-2,4,8,11-13H,3,5-7,9-10H2,(H,22,24)(H3,20,21,23);2*1H3.
What are the key properties of azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine?
azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine has a molecular weight of 371.49 g/mol, XLogP of 3.76, 5 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-N-[2-(oxan-4-yl)ethyl]-7-(1H-pyrazol-5-yl)quinoline-2,4-diamine is sourced from PubChem (CID 137409071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).