C16H21IN4O3 — CID 137409197
8-iodo-N-(1-methoxypropan-2-yl)-5-(oxan-4-yloxy)pyrido[4,3-d]pyrimidin-2-amine (PubChem CID 137409197) has the molecular formula C16H21IN4O3 and a molecular weight of 444.27 g/mol. Its IUPAC name is 8-iodo-N-(1-methoxypropan-2-yl)-5-(oxan-4-yloxy)pyrido[4,3-d]pyrimidin-2-amine.
| Compound Name | 8-iodo-N-(1-methoxypropan-2-yl)-5-(oxan-4-yloxy)pyrido[4,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 137409197 |
| Molecular Formula | C16H21IN4O3 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 8-iodo-N-(1-methoxypropan-2-yl)-5-(oxan-4-yloxy)pyrido[4,3-d]pyrimidin-2-amine |
| SMILES | COCC(C)Nc1ncc2c(OC3CCOCC3)ncc(I)c2n1 |
| InChI | InChI=1S/C16H21IN4O3/c1-10(9-22-2)20-16-19-7-12-14(21-16)13(17)8-18-15(12)24-11-3-5-23-6-4-11/h7-8,10-11H,3-6,9H2,1-2H3,(H,19,20,21) |
| InChIKey | MZTSWYPSLSLOER-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|