C13H9Cl2N3O — CID 137409510
2-[(2,6-dichloropyrimidin-4-yl)methyl]-3H-isoindol-1-one (PubChem CID 137409510) has the molecular formula C13H9Cl2N3O and a molecular weight of 294.14 g/mol. Its IUPAC name is 2-[(2,6-dichloropyrimidin-4-yl)methyl]-3H-isoindol-1-one.
| Compound Name | 2-[(2,6-dichloropyrimidin-4-yl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 137409510 |
| Molecular Formula | C13H9Cl2N3O |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-[(2,6-dichloropyrimidin-4-yl)methyl]-3H-isoindol-1-one |
| SMILES | O=C1c2ccccc2CN1Cc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C13H9Cl2N3O/c14-11-5-9(16-13(15)17-11)7-18-6-8-3-1-2-4-10(8)12(18)19/h1-5H,6-7H2 |
| InChIKey | FZMQZFOGSBZPOT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |