C22H23NO3 — CID 137409998
(3aS,9bR)-8-[(3-aminophenyl)methoxy]-6,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2-one (PubChem CID 137409998) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3aS,9bR)-8-[(3-aminophenyl)methoxy]-6,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2-one.
| Compound Name | (3aS,9bR)-8-[(3-aminophenyl)methoxy]-6,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 137409998 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (3aS,9bR)-8-[(3-aminophenyl)methoxy]-6,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2-one |
| SMILES | C=C1C(=O)O[C@H]2c3c(C)c(OCc4cccc(N)c4)cc(C)c3CC[C@@H]12 |
| InChI | InChI=1S/C22H23NO3/c1-12-9-19(25-11-15-5-4-6-16(23)10-15)14(3)20-17(12)7-8-18-13(2)22(24)26-21(18)20/h4-6,9-10,18,21H,2,7-8,11,23H2,1,3H3/t18-,21+/m0/s1 |
| InChIKey | XGFGRMGUEXBRQU-GHTZIAJQSA-N |
| XLogP | 4.18 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|