C20H33FN4 — CID 137410324
(1R)-1-N'-[(3Z)-3-[(E)-2-(ethylideneamino)-1-propan-2-ylprop-1-enyl]-6-iminohepta-1,3-dien-2-yl]-2-fluoropent-4-ene-1,1-diamine (PubChem CID 137410324) has the molecular formula C20H33FN4 and a molecular weight of 348.51 g/mol. Its IUPAC name is (1R)-1-N'-[(3Z)-3-[(E)-2-(ethylideneamino)-1-propan-2-ylprop-1-enyl]-6-iminohepta-1,3-dien-2-yl]-2-fluoropent-4-ene-1,1-diamine.
| Compound Name | (1R)-1-N'-[(3Z)-3-[(E)-2-(ethylideneamino)-1-propan-2-ylprop-1-enyl]-6-iminohepta-1,3-dien-2-yl]-2-fluoropent-4-ene-1,1-diamine |
|---|---|
| PubChem CID | 137410324 |
| Molecular Formula | C20H33FN4 |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (1R)-1-N'-[(3Z)-3-[(E)-2-(ethylideneamino)-1-propan-2-ylprop-1-enyl]-6-iminohepta-1,3-dien-2-yl]-2-fluoropent-4-ene-1,1-diamine |
| SMILES | [H]/N=C(\C)C/C=C(C(=C)N[C@@H](N)C(F)CC=C)/C(=C(C)/N=C/C)C(C)C |
| InChI | InChI=1S/C20H33FN4/c1-8-10-18(21)20(23)25-15(6)17(12-11-14(5)22)19(13(3)4)16(7)24-9-2/h8-9,12-13,18,20,22,25H,1,6,10-11,23H2,2-5,7H3/b17-12+,19-16+,22-14+,24-9+/t18?,20-/m1/s1 |
| InChIKey | DSRZOQGWGLMFHJ-XBZNVXAISA-N |
| XLogP | 4.67 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|