About (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine
(1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine (PubChem CID 137410330) has the molecular formula C11H20FN
and a molecular weight of 185.29 g/mol. Its IUPAC name is (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine.
Molecular Properties
| Compound Name | (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine |
| PubChem CID | 137410330 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine |
| SMILES | C/C=C\CC[C@@H]1C[C@@]1(F)[C@@H](C)NC |
| InChI | InChI=1S/C11H20FN/c1-4-5-6-7-10-8-11(10,12)9(2)13-3/h4-5,9-10,13H,6-8H2,1-3H3/b5-4-/t9-,10-,11-/m1/s1 |
| InChIKey | BKBVPQLPDVZXFV-LOTCAWRZSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine?
The IUPAC name of (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine (CID 137410330) is (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine.
What is the SMILES notation for (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine?
The canonical SMILES for (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine is C/C=C\CC[C@@H]1C[C@@]1(F)[C@@H](C)NC.
What is the InChIKey of (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine?
The InChIKey is BKBVPQLPDVZXFV-LOTCAWRZSA-N. The full InChI is InChI=1S/C11H20FN/c1-4-5-6-7-10-8-11(10,12)9(2)13-3/h4-5,9-10,13H,6-8H2,1-3H3/b5-4-/t9-,10-,11-/m1/s1.
What are the key properties of (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine?
(1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine has a molecular weight of 185.29 g/mol, XLogP of 2.68, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[(1S,2R)-1-fluoro-2-[(Z)-pent-3-enyl]cyclopropyl]-N-methylethanamine is sourced from PubChem (CID 137410330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).