C14H15F7O — CID 137410439
1-(4,4-difluoro-5-methylheptan-3-yl)oxy-2,3,4,5,6-pentafluorobenzene (PubChem CID 137410439) has the molecular formula C14H15F7O and a molecular weight of 332.26 g/mol. Its IUPAC name is 1-(4,4-difluoro-5-methylheptan-3-yl)oxy-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-(4,4-difluoro-5-methylheptan-3-yl)oxy-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 137410439 |
| Molecular Formula | C14H15F7O |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-(4,4-difluoro-5-methylheptan-3-yl)oxy-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCC(C)C(F)(F)C(CC)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H15F7O/c1-4-6(3)14(20,21)7(5-2)22-13-11(18)9(16)8(15)10(17)12(13)19/h6-7H,4-5H2,1-3H3 |
| InChIKey | LERYSFLSNAFPOJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|