C11H22F2O2 — CID 137410444
2,4-diethyl-3,3-difluoro-2,4-dimethylpentane-1,5-diol (PubChem CID 137410444) has the molecular formula C11H22F2O2 and a molecular weight of 224.29 g/mol. Its IUPAC name is 2,4-diethyl-3,3-difluoro-2,4-dimethylpentane-1,5-diol.
| Compound Name | 2,4-diethyl-3,3-difluoro-2,4-dimethylpentane-1,5-diol |
|---|---|
| PubChem CID | 137410444 |
| Molecular Formula | C11H22F2O2 |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2,4-diethyl-3,3-difluoro-2,4-dimethylpentane-1,5-diol |
| SMILES | CCC(C)(CO)C(F)(F)C(C)(CC)CO |
| InChI | InChI=1S/C11H22F2O2/c1-5-9(3,7-14)11(12,13)10(4,6-2)8-15/h14-15H,5-8H2,1-4H3 |
| InChIKey | SQAPSKLDVMSNKD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |