About 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene
2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene (PubChem CID 137410685) has the molecular formula C13H24S
and a molecular weight of 212.40 g/mol. Its IUPAC name is 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene.
Molecular Properties
| Compound Name | 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene |
| PubChem CID | 137410685 |
| Molecular Formula | C13H24S |
| Molecular Weight | 212.40 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene |
| SMILES | CCC1=C(C(C)(C)CC)C(CC)SC1 |
| InChI | InChI=1S/C13H24S/c1-6-10-9-14-11(7-2)12(10)13(4,5)8-3/h11H,6-9H2,1-5H3 |
| InChIKey | JIBXWQJPKZMJCK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene?
The IUPAC name of 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene (CID 137410685) is 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene.
What is the SMILES notation for 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene?
The canonical SMILES for 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene is CCC1=C(C(C)(C)CC)C(CC)SC1.
What is the InChIKey of 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene?
The InChIKey is JIBXWQJPKZMJCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24S/c1-6-10-9-14-11(7-2)12(10)13(4,5)8-3/h11H,6-9H2,1-5H3.
What are the key properties of 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene?
2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene has a molecular weight of 212.40 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethyl-3-(2-methylbutan-2-yl)-2,5-dihydrothiophene is sourced from PubChem (CID 137410685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).