About 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide
3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide (PubChem CID 137411127) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide |
| PubChem CID | 137411127 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide |
| SMILES | CC(C)N1C=CNC(C(N)=O)C1=O |
| InChI | InChI=1S/C8H13N3O2/c1-5(2)11-4-3-10-6(7(9)12)8(11)13/h3-6,10H,1-2H3,(H2,9,12) |
| InChIKey | LYWVNIOODPCQNJ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide?
The IUPAC name of 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide (CID 137411127) is 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide.
What is the SMILES notation for 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide?
The canonical SMILES for 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide is CC(C)N1C=CNC(C(N)=O)C1=O.
What is the InChIKey of 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide?
The InChIKey is LYWVNIOODPCQNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-5(2)11-4-3-10-6(7(9)12)8(11)13/h3-6,10H,1-2H3,(H2,9,12).
What are the key properties of 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide?
3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide has a molecular weight of 183.21 g/mol, XLogP of -0.85, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-4-propan-2-yl-1,2-dihydropyrazine-2-carboxamide is sourced from PubChem (CID 137411127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).