C9H11F3OS — CID 137411203
2,2,2-trifluoro-1-(5-propan-2-ylthiophen-2-yl)ethanol (PubChem CID 137411203) has the molecular formula C9H11F3OS and a molecular weight of 224.25 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(5-propan-2-ylthiophen-2-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(5-propan-2-ylthiophen-2-yl)ethanol |
|---|---|
| PubChem CID | 137411203 |
| Molecular Formula | C9H11F3OS |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2,2,2-trifluoro-1-(5-propan-2-ylthiophen-2-yl)ethanol |
| SMILES | CC(C)c1ccc(C(O)C(F)(F)F)s1 |
| InChI | InChI=1S/C9H11F3OS/c1-5(2)6-3-4-7(14-6)8(13)9(10,11)12/h3-5,8,13H,1-2H3 |
| InChIKey | MDHQMFMCSZFCOW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |