C20H21ClFN3O3 — CID 137412235
methyl (2E,4Z,6Z)-4-chloro-8-[2-fluoro-4-(piperazine-1-carbonyl)phenyl]-8-iminoocta-2,4,6-trienoate (PubChem CID 137412235) has the molecular formula C20H21ClFN3O3 and a molecular weight of 405.86 g/mol. Its IUPAC name is methyl (2E,4Z,6Z)-4-chloro-8-[2-fluoro-4-(piperazine-1-carbonyl)phenyl]-8-iminoocta-2,4,6-trienoate.
| Compound Name | methyl (2E,4Z,6Z)-4-chloro-8-[2-fluoro-4-(piperazine-1-carbonyl)phenyl]-8-iminoocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 137412235 |
| Molecular Formula | C20H21ClFN3O3 |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | methyl (2E,4Z,6Z)-4-chloro-8-[2-fluoro-4-(piperazine-1-carbonyl)phenyl]-8-iminoocta-2,4,6-trienoate |
| SMILES | [H]/N=C(\C=C/C=C(Cl)/C=C/C(=O)OC)c1ccc(C(=O)N2CCNCC2)cc1F |
| InChI | InChI=1S/C20H21ClFN3O3/c1-28-19(26)8-6-15(21)3-2-4-18(23)16-7-5-14(13-17(16)22)20(27)25-11-9-24-10-12-25/h2-8,13,23-24H,9-12H2,1H3/b4-2-,8-6+,15-3-,23-18+ |
| InChIKey | MAICHPLYQISPFW-ARIUVXDXSA-N |
| XLogP | 2.65 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|