About 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine
8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine (PubChem CID 137412243) has the molecular formula C12H17NS
and a molecular weight of 207.34 g/mol. Its IUPAC name is 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine.
Molecular Properties
| Compound Name | 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine |
| PubChem CID | 137412243 |
| Molecular Formula | C12H17NS |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine |
| SMILES | CC(C)CC1=NCCC2=C1SCC=C2 |
| InChI | InChI=1S/C12H17NS/c1-9(2)8-11-12-10(5-6-13-11)4-3-7-14-12/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | GEVHKAFFYUQKJN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine?
The IUPAC name of 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine (CID 137412243) is 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine.
What is the SMILES notation for 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine?
The canonical SMILES for 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine is CC(C)CC1=NCCC2=C1SCC=C2.
What is the InChIKey of 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine?
The InChIKey is GEVHKAFFYUQKJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS/c1-9(2)8-11-12-10(5-6-13-11)4-3-7-14-12/h3-4,9H,5-8H2,1-2H3.
What are the key properties of 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine?
8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine has a molecular weight of 207.34 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-methylpropyl)-5,6-dihydro-2H-thiopyrano[2,3-c]pyridine is sourced from PubChem (CID 137412243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).