C20H22ClFN2O3 — CID 137412343
methyl (2E,4Z,6Z)-4-chloro-8-[3-(diethylcarbamoyl)-4-fluorophenyl]-8-iminoocta-2,4,6-trienoate (PubChem CID 137412343) has the molecular formula C20H22ClFN2O3 and a molecular weight of 392.86 g/mol. Its IUPAC name is methyl (2E,4Z,6Z)-4-chloro-8-[3-(diethylcarbamoyl)-4-fluorophenyl]-8-iminoocta-2,4,6-trienoate.
| Compound Name | methyl (2E,4Z,6Z)-4-chloro-8-[3-(diethylcarbamoyl)-4-fluorophenyl]-8-iminoocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 137412343 |
| Molecular Formula | C20H22ClFN2O3 |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | methyl (2E,4Z,6Z)-4-chloro-8-[3-(diethylcarbamoyl)-4-fluorophenyl]-8-iminoocta-2,4,6-trienoate |
| SMILES | [H]/N=C(\C=C/C=C(Cl)/C=C/C(=O)OC)c1ccc(F)c(C(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C20H22ClFN2O3/c1-4-24(5-2)20(26)16-13-14(9-11-17(16)22)18(23)8-6-7-15(21)10-12-19(25)27-3/h6-13,23H,4-5H2,1-3H3/b8-6-,12-10+,15-7-,23-18+ |
| InChIKey | ISKGAYIWNPCFKX-CWXLBCSMSA-N |
| XLogP | 4.08 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|