C14H16FN3O — CID 137412386
[(5R,7R)-5-buta-1,3-dien-2-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(1R,2S)-2-methylcyclopropyl]methanone (PubChem CID 137412386) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is [(5R,7R)-5-buta-1,3-dien-2-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(1R,2S)-2-methylcyclopropyl]methanone.
| Compound Name | [(5R,7R)-5-buta-1,3-dien-2-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(1R,2S)-2-methylcyclopropyl]methanone |
|---|---|
| PubChem CID | 137412386 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | [(5R,7R)-5-buta-1,3-dien-2-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-[(1R,2S)-2-methylcyclopropyl]methanone |
| SMILES | C=CC(=C)[C@H]1C[C@@H](F)c2nc(C(=O)[C@@H]3C[C@@H]3C)nn21 |
| InChI | InChI=1S/C14H16FN3O/c1-4-7(2)11-6-10(15)14-16-13(17-18(11)14)12(19)9-5-8(9)3/h4,8-11H,1-2,5-6H2,3H3/t8-,9+,10+,11+/m0/s1 |
| InChIKey | JCEMVVUGHGVAFG-LNFKQOIKSA-N |
| XLogP | 2.81 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|