C15H15F2N3O — CID 137412421
[(5S,7S)-5-cyclohexa-2,4-dien-1-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-(1-fluorocyclopropyl)methanone (PubChem CID 137412421) has the molecular formula C15H15F2N3O and a molecular weight of 291.30 g/mol. Its IUPAC name is [(5S,7S)-5-cyclohexa-2,4-dien-1-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-(1-fluorocyclopropyl)methanone.
| Compound Name | [(5S,7S)-5-cyclohexa-2,4-dien-1-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-(1-fluorocyclopropyl)methanone |
|---|---|
| PubChem CID | 137412421 |
| Molecular Formula | C15H15F2N3O |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [(5S,7S)-5-cyclohexa-2,4-dien-1-yl-7-fluoro-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-(1-fluorocyclopropyl)methanone |
| SMILES | O=C(c1nc2n(n1)[C@H](C1C=CC=CC1)C[C@@H]2F)C1(F)CC1 |
| InChI | InChI=1S/C15H15F2N3O/c16-10-8-11(9-4-2-1-3-5-9)20-14(10)18-13(19-20)12(21)15(17)6-7-15/h1-4,9-11H,5-8H2/t9?,10-,11-/m0/s1 |
| InChIKey | BPEMONWTZIHWMQ-DVRYWGNFSA-N |
| XLogP | 3.05 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |