C15H18ClN3O — CID 137412428
1-[(5S)-5-[(3E,5Z)-3-chlorohepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]propan-1-one (PubChem CID 137412428) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 1-[(5S)-5-[(3E,5Z)-3-chlorohepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]propan-1-one.
| Compound Name | 1-[(5S)-5-[(3E,5Z)-3-chlorohepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 137412428 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-[(5S)-5-[(3E,5Z)-3-chlorohepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]propan-1-one |
| SMILES | C=C(/C(Cl)=C\C=C/C)[C@@H]1CCc2nc(C(=O)CC)nn21 |
| InChI | InChI=1S/C15H18ClN3O/c1-4-6-7-11(16)10(3)12-8-9-14-17-15(13(20)5-2)18-19(12)14/h4,6-7,12H,3,5,8-9H2,1-2H3/b6-4-,11-7+/t12-/m0/s1 |
| InChIKey | NMFNHBXHHCVYGK-QSFOOOFLSA-N |
| XLogP | 3.61 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|