C16H17F2N3O — CID 137412434
cyclopropyl-[(5S,7S)-7-fluoro-5-(6-fluoro-1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone (PubChem CID 137412434) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is cyclopropyl-[(5S,7S)-7-fluoro-5-(6-fluoro-1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone.
| Compound Name | cyclopropyl-[(5S,7S)-7-fluoro-5-(6-fluoro-1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
|---|---|
| PubChem CID | 137412434 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | cyclopropyl-[(5S,7S)-7-fluoro-5-(6-fluoro-1-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]methanone |
| SMILES | CC1([C@@H]2C[C@H](F)c3nc(C(=O)C4CC4)nn32)C=CC=CC1F |
| InChI | InChI=1S/C16H17F2N3O/c1-16(7-3-2-4-11(16)18)12-8-10(17)15-19-14(20-21(12)15)13(22)9-5-6-9/h2-4,7,9-12H,5-6,8H2,1H3/t10-,11?,12-,16?/m0/s1 |
| InChIKey | MMLQXYMHXHQHOV-IRDPIATMSA-N |
| XLogP | 3.30 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |