C19H22FN3O — CID 137412436
[(5S,7S)-7-fluoro-5-(6-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-spiro[2.3]hexan-5-ylmethanone (PubChem CID 137412436) has the molecular formula C19H22FN3O and a molecular weight of 327.40 g/mol. Its IUPAC name is [(5S,7S)-7-fluoro-5-(6-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-spiro[2.3]hexan-5-ylmethanone.
| Compound Name | [(5S,7S)-7-fluoro-5-(6-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-spiro[2.3]hexan-5-ylmethanone |
|---|---|
| PubChem CID | 137412436 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | [(5S,7S)-7-fluoro-5-(6-methylcyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-spiro[2.3]hexan-5-ylmethanone |
| SMILES | CC1C=CC=CC1[C@@H]1C[C@H](F)c2nc(C(=O)C3CC4(CC4)C3)nn21 |
| InChI | InChI=1S/C19H22FN3O/c1-11-4-2-3-5-13(11)15-8-14(20)18-21-17(22-23(15)18)16(24)12-9-19(10-12)6-7-19/h2-5,11-15H,6-10H2,1H3/t11?,13?,14-,15-/m0/s1 |
| InChIKey | XEZVRLXQAGEPAW-MOQPVCNJSA-N |
| XLogP | 3.98 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |