C16H17F2N3 — CID 137412513
(5S,7S)-2-(1-cyclopropylethenyl)-7-fluoro-5-(4-fluorocyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole (PubChem CID 137412513) has the molecular formula C16H17F2N3 and a molecular weight of 289.33 g/mol. Its IUPAC name is (5S,7S)-2-(1-cyclopropylethenyl)-7-fluoro-5-(4-fluorocyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole.
| Compound Name | (5S,7S)-2-(1-cyclopropylethenyl)-7-fluoro-5-(4-fluorocyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
|---|---|
| PubChem CID | 137412513 |
| Molecular Formula | C16H17F2N3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (5S,7S)-2-(1-cyclopropylethenyl)-7-fluoro-5-(4-fluorocyclohexa-2,4-dien-1-yl)-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole |
| SMILES | C=C(c1nc2n(n1)[C@H](C1C=CC(F)=CC1)C[C@@H]2F)C1CC1 |
| InChI | InChI=1S/C16H17F2N3/c1-9(10-2-3-10)15-19-16-13(18)8-14(21(16)20-15)11-4-6-12(17)7-5-11/h4,6-7,10-11,13-14H,1-3,5,8H2/t11?,13-,14-/m0/s1 |
| InChIKey | QPYHWMQGAZKXQC-VNXPTHQBSA-N |
| XLogP | 4.09 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |