C18H19FN4O — CID 137412545
2-[1-[(5S,7S)-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carbonyl]cyclopropyl]acetonitrile (PubChem CID 137412545) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-[1-[(5S,7S)-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carbonyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[(5S,7S)-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carbonyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 137412545 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[1-[(5S,7S)-7-fluoro-5-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6,7-dihydro-5H-pyrrolo[1,2-b][1,2,4]triazole-2-carbonyl]cyclopropyl]acetonitrile |
| SMILES | C=C(/C=C\C=C/C)[C@@H]1C[C@H](F)c2nc(C(=O)C3(CC#N)CC3)nn21 |
| InChI | InChI=1S/C18H19FN4O/c1-3-4-5-6-12(2)14-11-13(19)17-21-16(22-23(14)17)15(24)18(7-8-18)9-10-20/h3-6,13-14H,2,7-9,11H2,1H3/b4-3-,6-5-/t13-,14-/m0/s1 |
| InChIKey | LXVUQGNJWFVVRT-SVUDMHSJSA-N |
| XLogP | 3.80 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|